C23H31N5O3 — CID 9116330
N-(2-methylphenyl)-2-[7-(2-methylpropyl)-2,6-dioxo-3-pentylpurin-1-yl]acetamide (PubChem CID 9116330) has the molecular formula C23H31N5O3 and a molecular weight of 425.53 g/mol. Its IUPAC name is N-(2-methylphenyl)-2-[7-(2-methylpropyl)-2,6-dioxo-3-pentylpurin-1-yl]acetamide.
| Compound Name | N-(2-methylphenyl)-2-[7-(2-methylpropyl)-2,6-dioxo-3-pentylpurin-1-yl]acetamide |
|---|---|
| PubChem CID | 9116330 |
| Molecular Formula | C23H31N5O3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | N-(2-methylphenyl)-2-[7-(2-methylpropyl)-2,6-dioxo-3-pentylpurin-1-yl]acetamide |
| SMILES | CCCCCn1c(=O)n(CC(=O)Nc2ccccc2C)c(=O)c2c1ncn2CC(C)C |
| InChI | InChI=1S/C23H31N5O3/c1-5-6-9-12-27-21-20(26(15-24-21)13-16(2)3)22(30)28(23(27)31)14-19(29)25-18-11-8-7-10-17(18)4/h7-8,10-11,15-16H,5-6,9,12-14H2,1-4H3,(H,25,29) |
| InChIKey | HBBKGJFIVVYREC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|