C28H27N5O3 — CID 3311804
2-[3-benzyl-7-(2-methylpropyl)-2,6-dioxopurin-1-yl]-N-naphthalen-1-ylacetamide (PubChem CID 3311804) has the molecular formula C28H27N5O3 and a molecular weight of 481.56 g/mol. Its IUPAC name is 2-[3-benzyl-7-(2-methylpropyl)-2,6-dioxopurin-1-yl]-N-naphthalen-1-ylacetamide.
| Compound Name | 2-[3-benzyl-7-(2-methylpropyl)-2,6-dioxopurin-1-yl]-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 3311804 |
| Molecular Formula | C28H27N5O3 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 2-[3-benzyl-7-(2-methylpropyl)-2,6-dioxopurin-1-yl]-N-naphthalen-1-ylacetamide |
| SMILES | CC(C)Cn1cnc2c1c(=O)n(CC(=O)Nc1cccc3ccccc13)c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C28H27N5O3/c1-19(2)15-31-18-29-26-25(31)27(35)33(28(36)32(26)16-20-9-4-3-5-10-20)17-24(34)30-23-14-8-12-21-11-6-7-13-22(21)23/h3-14,18-19H,15-17H2,1-2H3,(H,30,34) |
| InChIKey | PDHRGQMDAQMZLR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |