C24H24ClN5O3 — CID 4680324
2-[3-benzyl-7-(2-methylpropyl)-2,6-dioxopurin-1-yl]-N-(3-chlorophenyl)acetamide (PubChem CID 4680324) has the molecular formula C24H24ClN5O3 and a molecular weight of 465.94 g/mol. Its IUPAC name is 2-[3-benzyl-7-(2-methylpropyl)-2,6-dioxopurin-1-yl]-N-(3-chlorophenyl)acetamide.
| Compound Name | 2-[3-benzyl-7-(2-methylpropyl)-2,6-dioxopurin-1-yl]-N-(3-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 4680324 |
| Molecular Formula | C24H24ClN5O3 |
| Molecular Weight | 465.94 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 2-[3-benzyl-7-(2-methylpropyl)-2,6-dioxopurin-1-yl]-N-(3-chlorophenyl)acetamide |
| SMILES | CC(C)Cn1cnc2c1c(=O)n(CC(=O)Nc1cccc(Cl)c1)c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C24H24ClN5O3/c1-16(2)12-28-15-26-22-21(28)23(32)30(14-20(31)27-19-10-6-9-18(25)11-19)24(33)29(22)13-17-7-4-3-5-8-17/h3-11,15-16H,12-14H2,1-2H3,(H,27,31) |
| InChIKey | UDLQORDHKSEISZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.94 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |