C24H22N6O4 — CID 4839038
2-[3-benzyl-7-(2-methoxyethyl)-2,6-dioxopurin-1-yl]-N-(3-cyanophenyl)acetamide (PubChem CID 4839038) has the molecular formula C24H22N6O4 and a molecular weight of 458.48 g/mol. Its IUPAC name is 2-[3-benzyl-7-(2-methoxyethyl)-2,6-dioxopurin-1-yl]-N-(3-cyanophenyl)acetamide.
| Compound Name | 2-[3-benzyl-7-(2-methoxyethyl)-2,6-dioxopurin-1-yl]-N-(3-cyanophenyl)acetamide |
|---|---|
| PubChem CID | 4839038 |
| Molecular Formula | C24H22N6O4 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 2-[3-benzyl-7-(2-methoxyethyl)-2,6-dioxopurin-1-yl]-N-(3-cyanophenyl)acetamide |
| SMILES | COCCn1cnc2c1c(=O)n(CC(=O)Nc1cccc(C#N)c1)c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C24H22N6O4/c1-34-11-10-28-16-26-22-21(28)23(32)30(24(33)29(22)14-17-6-3-2-4-7-17)15-20(31)27-19-9-5-8-18(12-19)13-25/h2-9,12,16H,10-11,14-15H2,1H3,(H,27,31) |
| InChIKey | GSGHXTDESLDPPI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |