C17H19N5O4 — CID 3384406
2-[3-benzyl-7-(2-methoxyethyl)-2,6-dioxopurin-1-yl]acetamide (PubChem CID 3384406) has the molecular formula C17H19N5O4 and a molecular weight of 357.37 g/mol. Its IUPAC name is 2-[3-benzyl-7-(2-methoxyethyl)-2,6-dioxopurin-1-yl]acetamide.
| Compound Name | 2-[3-benzyl-7-(2-methoxyethyl)-2,6-dioxopurin-1-yl]acetamide |
|---|---|
| PubChem CID | 3384406 |
| Molecular Formula | C17H19N5O4 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 2-[3-benzyl-7-(2-methoxyethyl)-2,6-dioxopurin-1-yl]acetamide |
| SMILES | COCCn1cnc2c1c(=O)n(CC(N)=O)c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C17H19N5O4/c1-26-8-7-20-11-19-15-14(20)16(24)22(10-13(18)23)17(25)21(15)9-12-5-3-2-4-6-12/h2-6,11H,7-10H2,1H3,(H2,18,23) |
| InChIKey | ZEYGTSDTEJGBCZ-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |