C26H25N5O4 — CID 55510124
2-[3-benzyl-7-(2-methoxyethyl)-2,6-dioxopurin-1-yl]-N-(3-phenylprop-2-ynyl)acetamide (PubChem CID 55510124) has the molecular formula C26H25N5O4 and a molecular weight of 471.52 g/mol. Its IUPAC name is 2-[3-benzyl-7-(2-methoxyethyl)-2,6-dioxopurin-1-yl]-N-(3-phenylprop-2-ynyl)acetamide.
| Compound Name | 2-[3-benzyl-7-(2-methoxyethyl)-2,6-dioxopurin-1-yl]-N-(3-phenylprop-2-ynyl)acetamide |
|---|---|
| PubChem CID | 55510124 |
| Molecular Formula | C26H25N5O4 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 2-[3-benzyl-7-(2-methoxyethyl)-2,6-dioxopurin-1-yl]-N-(3-phenylprop-2-ynyl)acetamide |
| SMILES | COCCn1cnc2c1c(=O)n(CC(=O)NCC#Cc1ccccc1)c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C26H25N5O4/c1-35-16-15-29-19-28-24-23(29)25(33)31(26(34)30(24)17-21-11-6-3-7-12-21)18-22(32)27-14-8-13-20-9-4-2-5-10-20/h2-7,9-12,19H,14-18H2,1H3,(H,27,32) |
| InChIKey | ZEBIHPMIJIHOMB-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|