C24H33N5O5 — CID 24629009
2-[3-benzyl-7-(2-methoxyethyl)-2,6-dioxopurin-1-yl]-N-[3-(2-methylpropoxy)propyl]acetamide (PubChem CID 24629009) has the molecular formula C24H33N5O5 and a molecular weight of 471.56 g/mol. Its IUPAC name is 2-[3-benzyl-7-(2-methoxyethyl)-2,6-dioxopurin-1-yl]-N-[3-(2-methylpropoxy)propyl]acetamide.
| Compound Name | 2-[3-benzyl-7-(2-methoxyethyl)-2,6-dioxopurin-1-yl]-N-[3-(2-methylpropoxy)propyl]acetamide |
|---|---|
| PubChem CID | 24629009 |
| Molecular Formula | C24H33N5O5 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | 2-[3-benzyl-7-(2-methoxyethyl)-2,6-dioxopurin-1-yl]-N-[3-(2-methylpropoxy)propyl]acetamide |
| SMILES | COCCn1cnc2c1c(=O)n(CC(=O)NCCCOCC(C)C)c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C24H33N5O5/c1-18(2)16-34-12-7-10-25-20(30)15-29-23(31)21-22(26-17-27(21)11-13-33-3)28(24(29)32)14-19-8-5-4-6-9-19/h4-6,8-9,17-18H,7,10-16H2,1-3H3,(H,25,30) |
| InChIKey | KIESZDQKYHUNKJ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 109.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|