C27H22ClN5O3 — CID 26581077
N-(4-chlorophenyl)-2-(3,7-dibenzyl-2,6-dioxopurin-1-yl)acetamide (PubChem CID 26581077) has the molecular formula C27H22ClN5O3 and a molecular weight of 499.96 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(3,7-dibenzyl-2,6-dioxopurin-1-yl)acetamide.
| Compound Name | N-(4-chlorophenyl)-2-(3,7-dibenzyl-2,6-dioxopurin-1-yl)acetamide |
|---|---|
| PubChem CID | 26581077 |
| Molecular Formula | C27H22ClN5O3 |
| Molecular Weight | 499.96 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | N-(4-chlorophenyl)-2-(3,7-dibenzyl-2,6-dioxopurin-1-yl)acetamide |
| SMILES | O=C(Cn1c(=O)c2c(ncn2Cc2ccccc2)n(Cc2ccccc2)c1=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H22ClN5O3/c28-21-11-13-22(14-12-21)30-23(34)17-33-26(35)24-25(29-18-31(24)15-19-7-3-1-4-8-19)32(27(33)36)16-20-9-5-2-6-10-20/h1-14,18H,15-17H2,(H,30,34) |
| InChIKey | OIFRMRABFAFUHZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.96 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |