C34H29N5O4 — CID 5020978
2-(3,7-dibenzyl-2,6-dioxopurin-1-yl)-N-(4-phenylmethoxyphenyl)acetamide (PubChem CID 5020978) has the molecular formula C34H29N5O4 and a molecular weight of 571.64 g/mol. Its IUPAC name is 2-(3,7-dibenzyl-2,6-dioxopurin-1-yl)-N-(4-phenylmethoxyphenyl)acetamide.
| Compound Name | 2-(3,7-dibenzyl-2,6-dioxopurin-1-yl)-N-(4-phenylmethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 5020978 |
| Molecular Formula | C34H29N5O4 |
| Molecular Weight | 571.64 g/mol |
| Exact Mass | 571.22 |
| IUPAC Name | 2-(3,7-dibenzyl-2,6-dioxopurin-1-yl)-N-(4-phenylmethoxyphenyl)acetamide |
| SMILES | O=C(Cn1c(=O)c2c(ncn2Cc2ccccc2)n(Cc2ccccc2)c1=O)Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C34H29N5O4/c40-30(36-28-16-18-29(19-17-28)43-23-27-14-8-3-9-15-27)22-39-33(41)31-32(35-24-37(31)20-25-10-4-1-5-11-25)38(34(39)42)21-26-12-6-2-7-13-26/h1-19,24H,20-23H2,(H,36,40) |
| InChIKey | ZZUBZELBULMVDY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.64 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |