C24H25N7O5 — CID 25478228
1-[[2-(3-benzyl-7-ethyl-2,6-dioxopurin-1-yl)acetyl]amino]-3-(2-methoxyphenyl)urea (PubChem CID 25478228) has the molecular formula C24H25N7O5 and a molecular weight of 491.51 g/mol. Its IUPAC name is 1-[[2-(3-benzyl-7-ethyl-2,6-dioxopurin-1-yl)acetyl]amino]-3-(2-methoxyphenyl)urea.
| Compound Name | 1-[[2-(3-benzyl-7-ethyl-2,6-dioxopurin-1-yl)acetyl]amino]-3-(2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 25478228 |
| Molecular Formula | C24H25N7O5 |
| Molecular Weight | 491.51 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 1-[[2-(3-benzyl-7-ethyl-2,6-dioxopurin-1-yl)acetyl]amino]-3-(2-methoxyphenyl)urea |
| SMILES | CCn1cnc2c1c(=O)n(CC(=O)NNC(=O)Nc1ccccc1OC)c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C24H25N7O5/c1-3-29-15-25-21-20(29)22(33)31(24(35)30(21)13-16-9-5-4-6-10-16)14-19(32)27-28-23(34)26-17-11-7-8-12-18(17)36-2/h4-12,15H,3,13-14H2,1-2H3,(H,27,32)(H2,26,28,34) |
| InChIKey | XIOPNXWRPLKLKI-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 141.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.51 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|