C23H21FN6O4 — CID 41388020
N'-[2-(3-benzyl-7-ethyl-2,6-dioxopurin-1-yl)acetyl]-2-fluorobenzohydrazide (PubChem CID 41388020) has the molecular formula C23H21FN6O4 and a molecular weight of 464.46 g/mol. Its IUPAC name is N'-[2-(3-benzyl-7-ethyl-2,6-dioxopurin-1-yl)acetyl]-2-fluorobenzohydrazide.
| Compound Name | N'-[2-(3-benzyl-7-ethyl-2,6-dioxopurin-1-yl)acetyl]-2-fluorobenzohydrazide |
|---|---|
| PubChem CID | 41388020 |
| Molecular Formula | C23H21FN6O4 |
| Molecular Weight | 464.46 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | N'-[2-(3-benzyl-7-ethyl-2,6-dioxopurin-1-yl)acetyl]-2-fluorobenzohydrazide |
| SMILES | CCn1cnc2c1c(=O)n(CC(=O)NNC(=O)c1ccccc1F)c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C23H21FN6O4/c1-2-28-14-25-20-19(28)22(33)30(23(34)29(20)12-15-8-4-3-5-9-15)13-18(31)26-27-21(32)16-10-6-7-11-17(16)24/h3-11,14H,2,12-13H2,1H3,(H,26,31)(H,27,32) |
| InChIKey | DTCDSOKDYMLKBI-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.46 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|