C26H23N7O4 — CID 41388014
N'-[2-(3-benzyl-7-ethyl-2,6-dioxopurin-1-yl)acetyl]quinoline-2-carbohydrazide (PubChem CID 41388014) has the molecular formula C26H23N7O4 and a molecular weight of 497.52 g/mol. Its IUPAC name is N'-[2-(3-benzyl-7-ethyl-2,6-dioxopurin-1-yl)acetyl]quinoline-2-carbohydrazide.
| Compound Name | N'-[2-(3-benzyl-7-ethyl-2,6-dioxopurin-1-yl)acetyl]quinoline-2-carbohydrazide |
|---|---|
| PubChem CID | 41388014 |
| Molecular Formula | C26H23N7O4 |
| Molecular Weight | 497.52 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | N'-[2-(3-benzyl-7-ethyl-2,6-dioxopurin-1-yl)acetyl]quinoline-2-carbohydrazide |
| SMILES | CCn1cnc2c1c(=O)n(CC(=O)NNC(=O)c1ccc3ccccc3n1)c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C26H23N7O4/c1-2-31-16-27-23-22(31)25(36)33(26(37)32(23)14-17-8-4-3-5-9-17)15-21(34)29-30-24(35)20-13-12-18-10-6-7-11-19(18)28-20/h3-13,16H,2,14-15H2,1H3,(H,29,34)(H,30,35) |
| InChIKey | CDNXEMBZOXBDHZ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 132.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.52 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|