C25H26N6O4 — CID 41388055
N'-[2-(3-benzyl-7-ethyl-2,6-dioxopurin-1-yl)acetyl]-2-(2-methylphenyl)acetohydrazide (PubChem CID 41388055) has the molecular formula C25H26N6O4 and a molecular weight of 474.52 g/mol. Its IUPAC name is N'-[2-(3-benzyl-7-ethyl-2,6-dioxopurin-1-yl)acetyl]-2-(2-methylphenyl)acetohydrazide.
| Compound Name | N'-[2-(3-benzyl-7-ethyl-2,6-dioxopurin-1-yl)acetyl]-2-(2-methylphenyl)acetohydrazide |
|---|---|
| PubChem CID | 41388055 |
| Molecular Formula | C25H26N6O4 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | N'-[2-(3-benzyl-7-ethyl-2,6-dioxopurin-1-yl)acetyl]-2-(2-methylphenyl)acetohydrazide |
| SMILES | CCn1cnc2c1c(=O)n(CC(=O)NNC(=O)Cc1ccccc1C)c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C25H26N6O4/c1-3-29-16-26-23-22(29)24(34)31(25(35)30(23)14-18-10-5-4-6-11-18)15-21(33)28-27-20(32)13-19-12-8-7-9-17(19)2/h4-12,16H,3,13-15H2,1-2H3,(H,27,32)(H,28,33) |
| InChIKey | QNXICRNIWAMRPW-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|