C24H25N5O3 — CID 17399179
N-benzyl-2-(3-benzyl-7-ethyl-2,6-dioxopurin-1-yl)-N-methylacetamide (PubChem CID 17399179) has the molecular formula C24H25N5O3 and a molecular weight of 431.50 g/mol. Its IUPAC name is N-benzyl-2-(3-benzyl-7-ethyl-2,6-dioxopurin-1-yl)-N-methylacetamide.
| Compound Name | N-benzyl-2-(3-benzyl-7-ethyl-2,6-dioxopurin-1-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 17399179 |
| Molecular Formula | C24H25N5O3 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | N-benzyl-2-(3-benzyl-7-ethyl-2,6-dioxopurin-1-yl)-N-methylacetamide |
| SMILES | CCn1cnc2c1c(=O)n(CC(=O)N(C)Cc1ccccc1)c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C24H25N5O3/c1-3-27-17-25-22-21(27)23(31)29(24(32)28(22)15-19-12-8-5-9-13-19)16-20(30)26(2)14-18-10-6-4-7-11-18/h4-13,17H,3,14-16H2,1-2H3 |
| InChIKey | VUANJSKLJQNEOB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 82.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |