C23H30ClN5O3 — CID 24572591
N-(2-chloro-4,6-dimethylphenyl)-2-(3,7-dibutyl-2,6-dioxopurin-1-yl)acetamide (PubChem CID 24572591) has the molecular formula C23H30ClN5O3 and a molecular weight of 459.98 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-2-(3,7-dibutyl-2,6-dioxopurin-1-yl)acetamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-2-(3,7-dibutyl-2,6-dioxopurin-1-yl)acetamide |
|---|---|
| PubChem CID | 24572591 |
| Molecular Formula | C23H30ClN5O3 |
| Molecular Weight | 459.98 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-2-(3,7-dibutyl-2,6-dioxopurin-1-yl)acetamide |
| SMILES | CCCCn1cnc2c1c(=O)n(CC(=O)Nc1c(C)cc(C)cc1Cl)c(=O)n2CCCC |
| InChI | InChI=1S/C23H30ClN5O3/c1-5-7-9-27-14-25-21-20(27)22(31)29(23(32)28(21)10-8-6-2)13-18(30)26-19-16(4)11-15(3)12-17(19)24/h11-12,14H,5-10,13H2,1-4H3,(H,26,30) |
| InChIKey | YNFMANDZQNPGEZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.98 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |