C15H22N4O3 — CID 20601395
1-butyl-7-(2-oxopropyl)-3-propylpurine-2,6-dione (PubChem CID 20601395) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is 1-butyl-7-(2-oxopropyl)-3-propylpurine-2,6-dione.
| Compound Name | 1-butyl-7-(2-oxopropyl)-3-propylpurine-2,6-dione |
|---|---|
| PubChem CID | 20601395 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 1-butyl-7-(2-oxopropyl)-3-propylpurine-2,6-dione |
| SMILES | CCCCn1c(=O)c2c(ncn2CC(C)=O)n(CCC)c1=O |
| InChI | InChI=1S/C15H22N4O3/c1-4-6-8-19-14(21)12-13(18(7-5-2)15(19)22)16-10-17(12)9-11(3)20/h10H,4-9H2,1-3H3 |
| InChIKey | OQEAKRVOOBOTNC-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 78.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |