C20H30N4O4 — CID 10500610
3-methyl-1,7-bis(6-oxoheptyl)purine-2,6-dione (PubChem CID 10500610) has the molecular formula C20H30N4O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is 3-methyl-1,7-bis(6-oxoheptyl)purine-2,6-dione.
| Compound Name | 3-methyl-1,7-bis(6-oxoheptyl)purine-2,6-dione |
|---|---|
| PubChem CID | 10500610 |
| Molecular Formula | C20H30N4O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 3-methyl-1,7-bis(6-oxoheptyl)purine-2,6-dione |
| SMILES | CC(=O)CCCCCn1c(=O)c2c(ncn2CCCCCC(C)=O)n(C)c1=O |
| InChI | InChI=1S/C20H30N4O4/c1-15(25)10-6-4-8-12-23-14-21-18-17(23)19(27)24(20(28)22(18)3)13-9-5-7-11-16(2)26/h14H,4-13H2,1-3H3 |
| InChIKey | MRAYRZWRLTWPEW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 95.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|