C16H24N4O5 — CID 151846663
ethyl 5-[7-(ethoxymethyl)-3-methyl-2,6-dioxopurin-1-yl]pentanoate (PubChem CID 151846663) has the molecular formula C16H24N4O5 and a molecular weight of 352.39 g/mol. Its IUPAC name is ethyl 5-[7-(ethoxymethyl)-3-methyl-2,6-dioxopurin-1-yl]pentanoate.
| Compound Name | ethyl 5-[7-(ethoxymethyl)-3-methyl-2,6-dioxopurin-1-yl]pentanoate |
|---|---|
| PubChem CID | 151846663 |
| Molecular Formula | C16H24N4O5 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | ethyl 5-[7-(ethoxymethyl)-3-methyl-2,6-dioxopurin-1-yl]pentanoate |
| SMILES | CCOCn1cnc2c1c(=O)n(CCCCC(=O)OCC)c(=O)n2C |
| InChI | InChI=1S/C16H24N4O5/c1-4-24-11-19-10-17-14-13(19)15(22)20(16(23)18(14)3)9-7-6-8-12(21)25-5-2/h10H,4-9,11H2,1-3H3 |
| InChIKey | SHUILBPFZHPGFZ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 97.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|