C13H23N5O6P+ — CID 67653410
azanium 4-[7-(ethoxymethyl)-3-methyl-2,6-dioxopurin-1-yl]butoxy-oxido-oxophosphanium (PubChem CID 67653410) has the molecular formula C13H23N5O6P+ and a molecular weight of 376.33 g/mol. Its IUPAC name is azanium 4-[7-(ethoxymethyl)-3-methyl-2,6-dioxopurin-1-yl]butoxy-oxido-oxophosphanium.
| Compound Name | azanium 4-[7-(ethoxymethyl)-3-methyl-2,6-dioxopurin-1-yl]butoxy-oxido-oxophosphanium |
|---|---|
| PubChem CID | 67653410 |
| Molecular Formula | C13H23N5O6P+ |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | azanium 4-[7-(ethoxymethyl)-3-methyl-2,6-dioxopurin-1-yl]butoxy-oxido-oxophosphanium |
| SMILES | CCOCn1cnc2c1c(=O)n(CCCCO[P+](=O)[O-])c(=O)n2C.[NH4+] |
| InChI | InChI=1S/C13H19N4O6P.H3N/c1-3-22-9-16-8-14-11-10(16)12(18)17(13(19)15(11)2)6-4-5-7-23-24(20)21;/h8H,3-7,9H2,1-2H3;1H3/p+1 |
| InChIKey | DSCFSUHRGZRUDF-UHFFFAOYSA-O |
| XLogP | 0.08 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|