C19H33N4O5P — CID 22446280
7-(4-diethoxyphosphorylbutyl)-3-methyl-1-(3-methylbutyl)purine-2,6-dione (PubChem CID 22446280) has the molecular formula C19H33N4O5P and a molecular weight of 428.47 g/mol. Its IUPAC name is 7-(4-diethoxyphosphorylbutyl)-3-methyl-1-(3-methylbutyl)purine-2,6-dione.
| Compound Name | 7-(4-diethoxyphosphorylbutyl)-3-methyl-1-(3-methylbutyl)purine-2,6-dione |
|---|---|
| PubChem CID | 22446280 |
| Molecular Formula | C19H33N4O5P |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 7-(4-diethoxyphosphorylbutyl)-3-methyl-1-(3-methylbutyl)purine-2,6-dione |
| SMILES | CCOP(=O)(CCCCn1cnc2c1c(=O)n(CCC(C)C)c(=O)n2C)OCC |
| InChI | InChI=1S/C19H33N4O5P/c1-6-27-29(26,28-7-2)13-9-8-11-22-14-20-17-16(22)18(24)23(12-10-15(3)4)19(25)21(17)5/h14-15H,6-13H2,1-5H3 |
| InChIKey | BZKKQJJGVHUXQP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 97.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|