C31H41N4O6P — CID 19689141
1-[4-[bis(1-phenylpropan-2-yloxy)phosphoryl]butyl]-7-(ethoxymethyl)-3-methylpurine-2,6-dione (PubChem CID 19689141) has the molecular formula C31H41N4O6P and a molecular weight of 596.67 g/mol. Its IUPAC name is 1-[4-[bis(1-phenylpropan-2-yloxy)phosphoryl]butyl]-7-(ethoxymethyl)-3-methylpurine-2,6-dione.
| Compound Name | 1-[4-[bis(1-phenylpropan-2-yloxy)phosphoryl]butyl]-7-(ethoxymethyl)-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 19689141 |
| Molecular Formula | C31H41N4O6P |
| Molecular Weight | 596.67 g/mol |
| Exact Mass | 596.28 |
| IUPAC Name | 1-[4-[bis(1-phenylpropan-2-yloxy)phosphoryl]butyl]-7-(ethoxymethyl)-3-methylpurine-2,6-dione |
| SMILES | CCOCn1cnc2c1c(=O)n(CCCCP(=O)(OC(C)Cc1ccccc1)OC(C)Cc1ccccc1)c(=O)n2C |
| InChI | InChI=1S/C31H41N4O6P/c1-5-39-23-34-22-32-29-28(34)30(36)35(31(37)33(29)4)18-12-13-19-42(38,40-24(2)20-26-14-8-6-9-15-26)41-25(3)21-27-16-10-7-11-17-27/h6-11,14-17,22,24-25H,5,12-13,18-21,23H2,1-4H3 |
| InChIKey | SQOBDGLQKHPMMC-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 106.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.67 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|