C17H20N4O5P+ — CID 67652927
4-(7-benzyl-3-methyl-2,6-dioxopurin-1-yl)butoxy-hydroxy-oxophosphanium (PubChem CID 67652927) has the molecular formula C17H20N4O5P+ and a molecular weight of 391.34 g/mol. Its IUPAC name is 4-(7-benzyl-3-methyl-2,6-dioxopurin-1-yl)butoxy-hydroxy-oxophosphanium.
| Compound Name | 4-(7-benzyl-3-methyl-2,6-dioxopurin-1-yl)butoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 67652927 |
| Molecular Formula | C17H20N4O5P+ |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 4-(7-benzyl-3-methyl-2,6-dioxopurin-1-yl)butoxy-hydroxy-oxophosphanium |
| SMILES | Cn1c(=O)n(CCCCO[P+](=O)O)c(=O)c2c1ncn2Cc1ccccc1 |
| InChI | InChI=1S/C17H19N4O5P/c1-19-15-14(20(12-18-15)11-13-7-3-2-4-8-13)16(22)21(17(19)23)9-5-6-10-26-27(24)25/h2-4,7-8,12H,5-6,9-11H2,1H3/p+1 |
| InChIKey | AOGSXZYSBHXJDA-UHFFFAOYSA-O |
| XLogP | 1.39 |
| TPSA | 108.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|