C11H16N4O5P+ — CID 67654072
hydroxy-[5-(3-methyl-2,6-dioxo-7H-purin-1-yl)pentoxy]-oxophosphanium (PubChem CID 67654072) has the molecular formula C11H16N4O5P+ and a molecular weight of 315.25 g/mol. Its IUPAC name is hydroxy-[5-(3-methyl-2,6-dioxo-7H-purin-1-yl)pentoxy]-oxophosphanium.
| Compound Name | hydroxy-[5-(3-methyl-2,6-dioxo-7H-purin-1-yl)pentoxy]-oxophosphanium |
|---|---|
| PubChem CID | 67654072 |
| Molecular Formula | C11H16N4O5P+ |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | hydroxy-[5-(3-methyl-2,6-dioxo-7H-purin-1-yl)pentoxy]-oxophosphanium |
| SMILES | Cn1c(=O)n(CCCCCO[P+](=O)O)c(=O)c2[nH]cnc21 |
| InChI | InChI=1S/C11H15N4O5P/c1-14-9-8(12-7-13-9)10(16)15(11(14)17)5-3-2-4-6-20-21(18)19/h7H,2-6H2,1H3,(H-,12,13,16,18,19)/p+1 |
| InChIKey | BCULNWUNPOTZHQ-UHFFFAOYSA-O |
| XLogP | 0.26 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|