C28H36N12O7 — CID 69293354
3,7-dimethyl-1-(5-oxohexyl)purine-2,6-dione;1,3-dimethyl-7H-purine-2,6-dione;1,3,7-trimethylpurine-2,6-dione (PubChem CID 69293354) has the molecular formula C28H36N12O7 and a molecular weight of 652.67 g/mol. Its IUPAC name is 3,7-dimethyl-1-(5-oxohexyl)purine-2,6-dione;1,3-dimethyl-7H-purine-2,6-dione;1,3,7-trimethylpurine-2,6-dione.
| Compound Name | 3,7-dimethyl-1-(5-oxohexyl)purine-2,6-dione;1,3-dimethyl-7H-purine-2,6-dione;1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 69293354 |
| Molecular Formula | C28H36N12O7 |
| Molecular Weight | 652.67 g/mol |
| Exact Mass | 652.28 |
| IUPAC Name | 3,7-dimethyl-1-(5-oxohexyl)purine-2,6-dione;1,3-dimethyl-7H-purine-2,6-dione;1,3,7-trimethylpurine-2,6-dione |
| SMILES | CC(=O)CCCCn1c(=O)c2c(ncn2C)n(C)c1=O.Cn1c(=O)c2[nH]cnc2n(C)c1=O.Cn1c(=O)c2c(ncn2C)n(C)c1=O |
| InChI | InChI=1S/C13H18N4O3.C8H10N4O2.C7H8N4O2/c1-9(18)6-4-5-7-17-12(19)10-11(14-8-15(10)2)16(3)13(17)20;1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2;1-10-5-4(8-3-9-5)6(12)11(2)7(10)13/h8H,4-7H2,1-3H3;4H,1-3H3;3H,1-2H3,(H,8,9) |
| InChIKey | OESBRIVJVMVRQJ-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 213.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.67 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|