C19H24N8O5 — CID 70053798
3,7-dimethyl-1-(5-oxohexyl)purine-2,6-dione;1-methyl-3,7-dihydropurine-2,6-dione (PubChem CID 70053798) has the molecular formula C19H24N8O5 and a molecular weight of 444.45 g/mol. Its IUPAC name is 3,7-dimethyl-1-(5-oxohexyl)purine-2,6-dione;1-methyl-3,7-dihydropurine-2,6-dione.
| Compound Name | 3,7-dimethyl-1-(5-oxohexyl)purine-2,6-dione;1-methyl-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 70053798 |
| Molecular Formula | C19H24N8O5 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 3,7-dimethyl-1-(5-oxohexyl)purine-2,6-dione;1-methyl-3,7-dihydropurine-2,6-dione |
| SMILES | CC(=O)CCCCn1c(=O)c2c(ncn2C)n(C)c1=O.Cn1c(=O)[nH]c2nc[nH]c2c1=O |
| InChI | InChI=1S/C13H18N4O3.C6H6N4O2/c1-9(18)6-4-5-7-17-12(19)10-11(14-8-15(10)2)16(3)13(17)20;1-10-5(11)3-4(8-2-7-3)9-6(10)12/h8H,4-7H2,1-3H3;2H,1H3,(H,7,8)(H,9,12) |
| InChIKey | AITGJJDEYYQFTJ-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 162.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|