C22H31N5O4 — CID 145237806
3,7-dimethyl-1-(5-oxohexyl)purine-2,6-dione;propane;pyridine-3-carbaldehyde (PubChem CID 145237806) has the molecular formula C22H31N5O4 and a molecular weight of 429.52 g/mol. Its IUPAC name is 3,7-dimethyl-1-(5-oxohexyl)purine-2,6-dione;propane;pyridine-3-carbaldehyde.
| Compound Name | 3,7-dimethyl-1-(5-oxohexyl)purine-2,6-dione;propane;pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 145237806 |
| Molecular Formula | C22H31N5O4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 3,7-dimethyl-1-(5-oxohexyl)purine-2,6-dione;propane;pyridine-3-carbaldehyde |
| SMILES | CC(=O)CCCCn1c(=O)c2c(ncn2C)n(C)c1=O.CCC.O=Cc1cccnc1 |
| InChI | InChI=1S/C13H18N4O3.C6H5NO.C3H8/c1-9(18)6-4-5-7-17-12(19)10-11(14-8-15(10)2)16(3)13(17)20;8-5-6-2-1-3-7-4-6;1-3-2/h8H,4-7H2,1-3H3;1-5H;3H2,1-2H3 |
| InChIKey | AHPXUWGSWSVHDH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 108.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|