C26H37N5O10 — CID 24812746
3,7-dimethyl-1-(5-oxohexyl)purine-2,6-dione;2-(2-ethoxyethoxy)ethanol;pyridine-3,5-dicarboxylic acid (PubChem CID 24812746) has the molecular formula C26H37N5O10 and a molecular weight of 579.61 g/mol. Its IUPAC name is 3,7-dimethyl-1-(5-oxohexyl)purine-2,6-dione;2-(2-ethoxyethoxy)ethanol;pyridine-3,5-dicarboxylic acid.
| Compound Name | 3,7-dimethyl-1-(5-oxohexyl)purine-2,6-dione;2-(2-ethoxyethoxy)ethanol;pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 24812746 |
| Molecular Formula | C26H37N5O10 |
| Molecular Weight | 579.61 g/mol |
| Exact Mass | 579.25 |
| IUPAC Name | 3,7-dimethyl-1-(5-oxohexyl)purine-2,6-dione;2-(2-ethoxyethoxy)ethanol;pyridine-3,5-dicarboxylic acid |
| SMILES | CC(=O)CCCCn1c(=O)c2c(ncn2C)n(C)c1=O.CCOCCOCCO.O=C(O)c1cncc(C(=O)O)c1 |
| InChI | InChI=1S/C13H18N4O3.C7H5NO4.C6H14O3/c1-9(18)6-4-5-7-17-12(19)10-11(14-8-15(10)2)16(3)13(17)20;9-6(10)4-1-5(7(11)12)3-8-2-4;1-2-8-5-6-9-4-3-7/h8H,4-7H2,1-3H3;1-3H,(H,9,10)(H,11,12);7H,2-6H2,1H3 |
| InChIKey | WYJMXTUTHPMQFV-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 205.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.61 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|