C14H16Cl2N4O3Se — CID 174537042
1-benzyl-3,7-dimethylpurine-2,6-dione;chloro hypochlorite;selane (PubChem CID 174537042) has the molecular formula C14H16Cl2N4O3Se and a molecular weight of 438.17 g/mol. Its IUPAC name is 1-benzyl-3,7-dimethylpurine-2,6-dione;chloro hypochlorite;selane.
| Compound Name | 1-benzyl-3,7-dimethylpurine-2,6-dione;chloro hypochlorite;selane |
|---|---|
| PubChem CID | 174537042 |
| Molecular Formula | C14H16Cl2N4O3Se |
| Molecular Weight | 438.17 g/mol |
| Exact Mass | 437.98 |
| IUPAC Name | 1-benzyl-3,7-dimethylpurine-2,6-dione;chloro hypochlorite;selane |
| SMILES | ClOCl.Cn1cnc2c1c(=O)n(Cc1ccccc1)c(=O)n2C.[SeH2] |
| InChI | InChI=1S/C14H14N4O2.Cl2O.H2Se/c1-16-9-15-12-11(16)13(19)18(14(20)17(12)2)8-10-6-4-3-5-7-10;1-3-2;/h3-7,9H,8H2,1-2H3;;1H2 |
| InChIKey | AJOYFGRIFFAFKL-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.17 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|