C9H10N8O2 — CID 51058619
3,7-dimethyl-1-(2H-tetrazol-5-ylmethyl)purine-2,6-dione (PubChem CID 51058619) has the molecular formula C9H10N8O2 and a molecular weight of 262.23 g/mol. Its IUPAC name is 3,7-dimethyl-1-(2H-tetrazol-5-ylmethyl)purine-2,6-dione.
| Compound Name | 3,7-dimethyl-1-(2H-tetrazol-5-ylmethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 51058619 |
| Molecular Formula | C9H10N8O2 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 3,7-dimethyl-1-(2H-tetrazol-5-ylmethyl)purine-2,6-dione |
| SMILES | Cn1cnc2c1c(=O)n(Cc1nn[nH]n1)c(=O)n2C |
| InChI | InChI=1S/C9H10N8O2/c1-15-4-10-7-6(15)8(18)17(9(19)16(7)2)3-5-11-13-14-12-5/h4H,3H2,1-2H3,(H,11,12,13,14) |
| InChIKey | GYNDNVMTUNMZFH-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 116.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |