About 1-[(4-chloro-2-fluorophenyl)methyl]-3,7-dimethylpurine-2,6-dione
1-[(4-chloro-2-fluorophenyl)methyl]-3,7-dimethylpurine-2,6-dione (PubChem CID 625547) has the molecular formula C14H12ClFN4O2
and a molecular weight of 322.73 g/mol. Its IUPAC name is 1-[(4-chloro-2-fluorophenyl)methyl]-3,7-dimethylpurine-2,6-dione.
Molecular Properties
| Compound Name | 1-[(4-chloro-2-fluorophenyl)methyl]-3,7-dimethylpurine-2,6-dione |
| PubChem CID | 625547 |
| Molecular Formula | C14H12ClFN4O2 |
| Molecular Weight | 322.73 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 1-[(4-chloro-2-fluorophenyl)methyl]-3,7-dimethylpurine-2,6-dione |
| SMILES | Cn1cnc2c1c(=O)n(Cc1ccc(Cl)cc1F)c(=O)n2C |
| InChI | InChI=1S/C14H12ClFN4O2/c1-18-7-17-12-11(18)13(21)20(14(22)19(12)2)6-8-3-4-9(15)5-10(8)16/h3-5,7H,6H2,1-2H3 |
| InChIKey | IOLOKZUSKLCPOM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.73 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(4-chloro-2-fluorophenyl)methyl]-3,7-dimethylpurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-chloro-2-fluorophenyl)methyl]-3,7-dimethylpurine-2,6-dione?
The IUPAC name of 1-[(4-chloro-2-fluorophenyl)methyl]-3,7-dimethylpurine-2,6-dione (CID 625547) is 1-[(4-chloro-2-fluorophenyl)methyl]-3,7-dimethylpurine-2,6-dione.
What is the SMILES notation for 1-[(4-chloro-2-fluorophenyl)methyl]-3,7-dimethylpurine-2,6-dione?
The canonical SMILES for 1-[(4-chloro-2-fluorophenyl)methyl]-3,7-dimethylpurine-2,6-dione is Cn1cnc2c1c(=O)n(Cc1ccc(Cl)cc1F)c(=O)n2C.
What is the InChIKey of 1-[(4-chloro-2-fluorophenyl)methyl]-3,7-dimethylpurine-2,6-dione?
The InChIKey is IOLOKZUSKLCPOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12ClFN4O2/c1-18-7-17-12-11(18)13(21)20(14(22)19(12)2)6-8-3-4-9(15)5-10(8)16/h3-5,7H,6H2,1-2H3.
What are the key properties of 1-[(4-chloro-2-fluorophenyl)methyl]-3,7-dimethylpurine-2,6-dione?
1-[(4-chloro-2-fluorophenyl)methyl]-3,7-dimethylpurine-2,6-dione has a molecular weight of 322.73 g/mol, XLogP of 1.27, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-chloro-2-fluorophenyl)methyl]-3,7-dimethylpurine-2,6-dione is sourced from PubChem (CID 625547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).