C16H15ClN4O4 — CID 129249436
methyl 2-chloro-5-[(3,7-dimethyl-2,6-dioxopurin-1-yl)methyl]benzoate (PubChem CID 129249436) has the molecular formula C16H15ClN4O4 and a molecular weight of 362.77 g/mol. Its IUPAC name is methyl 2-chloro-5-[(3,7-dimethyl-2,6-dioxopurin-1-yl)methyl]benzoate.
| Compound Name | methyl 2-chloro-5-[(3,7-dimethyl-2,6-dioxopurin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 129249436 |
| Molecular Formula | C16H15ClN4O4 |
| Molecular Weight | 362.77 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | methyl 2-chloro-5-[(3,7-dimethyl-2,6-dioxopurin-1-yl)methyl]benzoate |
| SMILES | COC(=O)c1cc(Cn2c(=O)c3c(ncn3C)n(C)c2=O)ccc1Cl |
| InChI | InChI=1S/C16H15ClN4O4/c1-19-8-18-13-12(19)14(22)21(16(24)20(13)2)7-9-4-5-11(17)10(6-9)15(23)25-3/h4-6,8H,7H2,1-3H3 |
| InChIKey | KARDSVQZQPSTDK-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.77 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |