C16H15ClN4O4 — CID 78764624
(2-chlorophenyl)methyl 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetate (PubChem CID 78764624) has the molecular formula C16H15ClN4O4 and a molecular weight of 362.77 g/mol. Its IUPAC name is (2-chlorophenyl)methyl 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetate.
| Compound Name | (2-chlorophenyl)methyl 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetate |
|---|---|
| PubChem CID | 78764624 |
| Molecular Formula | C16H15ClN4O4 |
| Molecular Weight | 362.77 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | (2-chlorophenyl)methyl 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetate |
| SMILES | Cn1cnc2c1c(=O)n(CC(=O)OCc1ccccc1Cl)c(=O)n2C |
| InChI | InChI=1S/C16H15ClN4O4/c1-19-9-18-14-13(19)15(23)21(16(24)20(14)2)7-12(22)25-8-10-5-3-4-6-11(10)17/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | JODAAZBJLVQODS-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.77 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |