C20H18N6O7 — CID 55379014
[2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetate (PubChem CID 55379014) has the molecular formula C20H18N6O7 and a molecular weight of 454.40 g/mol. Its IUPAC name is [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetate.
| Compound Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetate |
|---|---|
| PubChem CID | 55379014 |
| Molecular Formula | C20H18N6O7 |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetate |
| SMILES | CN1C(=O)c2ccc(NC(=O)COC(=O)Cn3c(=O)c4c(ncn4C)n(C)c3=O)cc2C1=O |
| InChI | InChI=1S/C20H18N6O7/c1-23-9-21-16-15(23)19(31)26(20(32)24(16)2)7-14(28)33-8-13(27)22-10-4-5-11-12(6-10)18(30)25(3)17(11)29/h4-6,9H,7-8H2,1-3H3,(H,22,27) |
| InChIKey | RPCJNMSOACYNSB-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 154.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|