C23H23N5O5 — CID 26242408
2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-[4-(4-ethoxyphenoxy)phenyl]acetamide (PubChem CID 26242408) has the molecular formula C23H23N5O5 and a molecular weight of 449.47 g/mol. Its IUPAC name is 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-[4-(4-ethoxyphenoxy)phenyl]acetamide.
| Compound Name | 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-[4-(4-ethoxyphenoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 26242408 |
| Molecular Formula | C23H23N5O5 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-[4-(4-ethoxyphenoxy)phenyl]acetamide |
| SMILES | CCOc1ccc(Oc2ccc(NC(=O)Cn3c(=O)c4c(ncn4C)n(C)c3=O)cc2)cc1 |
| InChI | InChI=1S/C23H23N5O5/c1-4-32-16-9-11-18(12-10-16)33-17-7-5-15(6-8-17)25-19(29)13-28-22(30)20-21(24-14-26(20)2)27(3)23(28)31/h5-12,14H,4,13H2,1-3H3,(H,25,29) |
| InChIKey | NTGCKDIURACZFS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 109.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |