C15H14Cl2N6O3 — CID 51266113
N-(4-amino-3,5-dichlorophenyl)-2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetamide (PubChem CID 51266113) has the molecular formula C15H14Cl2N6O3 and a molecular weight of 397.22 g/mol. Its IUPAC name is N-(4-amino-3,5-dichlorophenyl)-2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetamide.
| Compound Name | N-(4-amino-3,5-dichlorophenyl)-2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetamide |
|---|---|
| PubChem CID | 51266113 |
| Molecular Formula | C15H14Cl2N6O3 |
| Molecular Weight | 397.22 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | N-(4-amino-3,5-dichlorophenyl)-2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetamide |
| SMILES | Cn1cnc2c1c(=O)n(CC(=O)Nc1cc(Cl)c(N)c(Cl)c1)c(=O)n2C |
| InChI | InChI=1S/C15H14Cl2N6O3/c1-21-6-19-13-12(21)14(25)23(15(26)22(13)2)5-10(24)20-7-3-8(16)11(18)9(17)4-7/h3-4,6H,5,18H2,1-2H3,(H,20,24) |
| InChIKey | XPLJSWMOCRRFTE-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.22 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|