C17H16ClN5O2 — CID 129249720
1-[(5-chloro-1-methylindol-2-yl)methyl]-3,7-dimethylpurine-2,6-dione (PubChem CID 129249720) has the molecular formula C17H16ClN5O2 and a molecular weight of 357.80 g/mol. Its IUPAC name is 1-[(5-chloro-1-methylindol-2-yl)methyl]-3,7-dimethylpurine-2,6-dione.
| Compound Name | 1-[(5-chloro-1-methylindol-2-yl)methyl]-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 129249720 |
| Molecular Formula | C17H16ClN5O2 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 1-[(5-chloro-1-methylindol-2-yl)methyl]-3,7-dimethylpurine-2,6-dione |
| SMILES | Cn1cnc2c1c(=O)n(Cc1cc3cc(Cl)ccc3n1C)c(=O)n2C |
| InChI | InChI=1S/C17H16ClN5O2/c1-20-9-19-15-14(20)16(24)23(17(25)22(15)3)8-12-7-10-6-11(18)4-5-13(10)21(12)2/h4-7,9H,8H2,1-3H3 |
| InChIKey | ZBCLUZFNXXZIKO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 66.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |