C17H21N5O2 — CID 672194
3,7-dimethyl-1-[2-[[(1S)-1-phenylethyl]amino]ethyl]purine-2,6-dione (PubChem CID 672194) has the molecular formula C17H21N5O2 and a molecular weight of 327.39 g/mol. Its IUPAC name is 3,7-dimethyl-1-[2-[[(1S)-1-phenylethyl]amino]ethyl]purine-2,6-dione.
| Compound Name | 3,7-dimethyl-1-[2-[[(1S)-1-phenylethyl]amino]ethyl]purine-2,6-dione |
|---|---|
| PubChem CID | 672194 |
| Molecular Formula | C17H21N5O2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 3,7-dimethyl-1-[2-[[(1S)-1-phenylethyl]amino]ethyl]purine-2,6-dione |
| SMILES | C[C@H](NCCn1c(=O)c2c(ncn2C)n(C)c1=O)c1ccccc1 |
| InChI | InChI=1S/C17H21N5O2/c1-12(13-7-5-4-6-8-13)18-9-10-22-16(23)14-15(19-11-20(14)2)21(3)17(22)24/h4-8,11-12,18H,9-10H2,1-3H3/t12-/m0/s1 |
| InChIKey | JXIXTDVBOYHMCW-LBPRGKRZSA-N |
| XLogP | 0.78 |
| TPSA | 73.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |