C19H31N5O3 — CID 91024621
3,7-dimethyl-1-(11-nitrosododecyl)purine-2,6-dione (PubChem CID 91024621) has the molecular formula C19H31N5O3 and a molecular weight of 377.49 g/mol. Its IUPAC name is 3,7-dimethyl-1-(11-nitrosododecyl)purine-2,6-dione.
| Compound Name | 3,7-dimethyl-1-(11-nitrosododecyl)purine-2,6-dione |
|---|---|
| PubChem CID | 91024621 |
| Molecular Formula | C19H31N5O3 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | 3,7-dimethyl-1-(11-nitrosododecyl)purine-2,6-dione |
| SMILES | CC(CCCCCCCCCCn1c(=O)c2c(ncn2C)n(C)c1=O)N=O |
| InChI | InChI=1S/C19H31N5O3/c1-15(21-27)12-10-8-6-4-5-7-9-11-13-24-18(25)16-17(20-14-22(16)2)23(3)19(24)26/h14-15H,4-13H2,1-3H3 |
| InChIKey | RSHLKWVDFAXYPJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 91.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|