C20H19N5O4 — CID 51217863
2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-[furan-2-yl(phenyl)methyl]acetamide (PubChem CID 51217863) has the molecular formula C20H19N5O4 and a molecular weight of 393.40 g/mol. Its IUPAC name is 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-[furan-2-yl(phenyl)methyl]acetamide.
| Compound Name | 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-[furan-2-yl(phenyl)methyl]acetamide |
|---|---|
| PubChem CID | 51217863 |
| Molecular Formula | C20H19N5O4 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-[furan-2-yl(phenyl)methyl]acetamide |
| SMILES | Cn1cnc2c1c(=O)n(CC(=O)NC(c1ccccc1)c1ccco1)c(=O)n2C |
| InChI | InChI=1S/C20H19N5O4/c1-23-12-21-18-17(23)19(27)25(20(28)24(18)2)11-15(26)22-16(14-9-6-10-29-14)13-7-4-3-5-8-13/h3-10,12,16H,11H2,1-2H3,(H,22,26) |
| InChIKey | QQJOZDZSZVHBMU-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |