C19H34IN5O2 — CID 3040789
1,3-dimethyl-7-[2-[methyl(6-methylheptan-2-yl)amino]ethyl]purine-2,6-dione;iodomethane (PubChem CID 3040789) has the molecular formula C19H34IN5O2 and a molecular weight of 491.42 g/mol. Its IUPAC name is 1,3-dimethyl-7-[2-[methyl(6-methylheptan-2-yl)amino]ethyl]purine-2,6-dione;iodomethane.
| Compound Name | 1,3-dimethyl-7-[2-[methyl(6-methylheptan-2-yl)amino]ethyl]purine-2,6-dione;iodomethane |
|---|---|
| PubChem CID | 3040789 |
| Molecular Formula | C19H34IN5O2 |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | 1,3-dimethyl-7-[2-[methyl(6-methylheptan-2-yl)amino]ethyl]purine-2,6-dione;iodomethane |
| SMILES | CC(C)CCCC(C)N(C)CCn1cnc2c1c(=O)n(C)c(=O)n2C.CI |
| InChI | InChI=1S/C18H31N5O2.CH3I/c1-13(2)8-7-9-14(3)20(4)10-11-23-12-19-16-15(23)17(24)22(6)18(25)21(16)5;1-2/h12-14H,7-11H2,1-6H3;1H3 |
| InChIKey | NUSQMBKIWZJCAF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 65.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|