C17H28N4O3 — CID 67820217
7-(7-hydroxydecyl)-1,3-dimethylpurine-2,6-dione (PubChem CID 67820217) has the molecular formula C17H28N4O3 and a molecular weight of 336.44 g/mol. Its IUPAC name is 7-(7-hydroxydecyl)-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-(7-hydroxydecyl)-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 67820217 |
| Molecular Formula | C17H28N4O3 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 7-(7-hydroxydecyl)-1,3-dimethylpurine-2,6-dione |
| SMILES | CCCC(O)CCCCCCn1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C17H28N4O3/c1-4-9-13(22)10-7-5-6-8-11-21-12-18-15-14(21)16(23)20(3)17(24)19(15)2/h12-13,22H,4-11H2,1-3H3 |
| InChIKey | UWHHTJHFYBEVLE-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|