C11H14N4O4 — CID 54398406
3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-2-methylpropanoic acid (PubChem CID 54398406) has the molecular formula C11H14N4O4 and a molecular weight of 266.26 g/mol. Its IUPAC name is 3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-2-methylpropanoic acid.
| Compound Name | 3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 54398406 |
| Molecular Formula | C11H14N4O4 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-2-methylpropanoic acid |
| SMILES | CC(Cn1cnc2c1c(=O)n(C)c(=O)n2C)C(=O)O |
| InChI | InChI=1S/C11H14N4O4/c1-6(10(17)18)4-15-5-12-8-7(15)9(16)14(3)11(19)13(8)2/h5-6H,4H2,1-3H3,(H,17,18) |
| InChIKey | VLQZZTPOLRMVJX-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |