C25H24N6O3 — CID 3435586
7-[3-(4,5-diphenylimidazol-1-yl)-2-hydroxypropyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 3435586) has the molecular formula C25H24N6O3 and a molecular weight of 456.51 g/mol. Its IUPAC name is 7-[3-(4,5-diphenylimidazol-1-yl)-2-hydroxypropyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[3-(4,5-diphenylimidazol-1-yl)-2-hydroxypropyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 3435586 |
| Molecular Formula | C25H24N6O3 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 7-[3-(4,5-diphenylimidazol-1-yl)-2-hydroxypropyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2CC(O)Cn2cnc(-c3ccccc3)c2-c2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C25H24N6O3/c1-28-23-22(24(33)29(2)25(28)34)31(16-27-23)14-19(32)13-30-15-26-20(17-9-5-3-6-10-17)21(30)18-11-7-4-8-12-18/h3-12,15-16,19,32H,13-14H2,1-2H3 |
| InChIKey | MQXWFYKOYHGBCX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |