C18H24N8O6 — CID 69348830
7-(2,3-dihydroxypropyl)-1,3-dimethylpurine-2,6-dione;1,3,7-trimethylpurine-2,6-dione (PubChem CID 69348830) has the molecular formula C18H24N8O6 and a molecular weight of 448.44 g/mol. Its IUPAC name is 7-(2,3-dihydroxypropyl)-1,3-dimethylpurine-2,6-dione;1,3,7-trimethylpurine-2,6-dione.
| Compound Name | 7-(2,3-dihydroxypropyl)-1,3-dimethylpurine-2,6-dione;1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 69348830 |
| Molecular Formula | C18H24N8O6 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 7-(2,3-dihydroxypropyl)-1,3-dimethylpurine-2,6-dione;1,3,7-trimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2C)n(C)c1=O.Cn1c(=O)c2c(ncn2CC(O)CO)n(C)c1=O |
| InChI | InChI=1S/C10H14N4O4.C8H10N4O2/c1-12-8-7(9(17)13(2)10(12)18)14(5-11-8)3-6(16)4-15;1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2/h5-6,15-16H,3-4H2,1-2H3;4H,1-3H3 |
| InChIKey | CQIYMSIJYWLPOU-UHFFFAOYSA-N |
| XLogP | -3.24 |
| TPSA | 164.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |