C9H12N4O2Pd — CID 175189767
methylidenepalladium;1,3,7-trimethylpurine-2,6-dione (PubChem CID 175189767) has the molecular formula C9H12N4O2Pd and a molecular weight of 314.64 g/mol. Its IUPAC name is methylidenepalladium;1,3,7-trimethylpurine-2,6-dione.
| Compound Name | methylidenepalladium;1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 175189767 |
| Molecular Formula | C9H12N4O2Pd |
| Molecular Weight | 314.64 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | methylidenepalladium;1,3,7-trimethylpurine-2,6-dione |
| SMILES | C=[Pd].Cn1c(=O)c2c(ncn2C)n(C)c1=O |
| InChI | InChI=1S/C8H10N4O2.CH2.Pd/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2;;/h4H,1-3H3;1H2; |
| InChIKey | TTWZHOYLHGLYOS-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.64 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |