C10H16N4O3 — CID 175086770
methoxymethane;1,3,7-trimethylpurine-2,6-dione (PubChem CID 175086770) has the molecular formula C10H16N4O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is methoxymethane;1,3,7-trimethylpurine-2,6-dione.
| Compound Name | methoxymethane;1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 175086770 |
| Molecular Formula | C10H16N4O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | methoxymethane;1,3,7-trimethylpurine-2,6-dione |
| SMILES | COC.Cn1c(=O)c2c(ncn2C)n(C)c1=O |
| InChI | InChI=1S/C8H10N4O2.C2H6O/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2;1-3-2/h4H,1-3H3;1-2H3 |
| InChIKey | NSGIJCHUZLYRGH-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |