C13H21N5O5 — CID 129318759
3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-2-hydroxy-N-(2-hydroxyethyl)-N-methylpropan-1-amine oxide (PubChem CID 129318759) has the molecular formula C13H21N5O5 and a molecular weight of 327.34 g/mol. Its IUPAC name is 3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-2-hydroxy-N-(2-hydroxyethyl)-N-methylpropan-1-amine oxide.
| Compound Name | 3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-2-hydroxy-N-(2-hydroxyethyl)-N-methylpropan-1-amine oxide |
|---|---|
| PubChem CID | 129318759 |
| Molecular Formula | C13H21N5O5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-2-hydroxy-N-(2-hydroxyethyl)-N-methylpropan-1-amine oxide |
| SMILES | Cn1c(=O)c2c(ncn2CC(O)C[N+](C)([O-])CCO)n(C)c1=O |
| InChI | InChI=1S/C13H21N5O5/c1-15-11-10(12(21)16(2)13(15)22)17(8-14-11)6-9(20)7-18(3,23)4-5-19/h8-9,19-20H,4-7H2,1-3H3 |
| InChIKey | ROXBXSVRDIMGEC-UHFFFAOYSA-N |
| XLogP | -2.27 |
| TPSA | 125.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|