C16H24N5O3+ — CID 6933242
[(2R)-3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-2-hydroxypropyl]-bis(prop-2-enyl)azanium (PubChem CID 6933242) has the molecular formula C16H24N5O3+ and a molecular weight of 334.40 g/mol. Its IUPAC name is [(2R)-3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-2-hydroxypropyl]-bis(prop-2-enyl)azanium.
| Compound Name | [(2R)-3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-2-hydroxypropyl]-bis(prop-2-enyl)azanium |
|---|---|
| PubChem CID | 6933242 |
| Molecular Formula | C16H24N5O3+ |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | [(2R)-3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-2-hydroxypropyl]-bis(prop-2-enyl)azanium |
| SMILES | C=CC[NH+](CC=C)C[C@H](O)Cn1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C16H23N5O3/c1-5-7-20(8-6-2)9-12(22)10-21-11-17-14-13(21)15(23)19(4)16(24)18(14)3/h5-6,11-12,22H,1-2,7-10H2,3-4H3/p+1/t12-/m0/s1 |
| InChIKey | YFKGNQQSCJXSDJ-LBPRGKRZSA-O |
| XLogP | -1.95 |
| TPSA | 86.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|