C14H21N5O4 — CID 23455270
4-[(1,3-dimethyl-2,6-dioxopurin-7-yl)methoxy]-N,N-dimethylbutanamide (PubChem CID 23455270) has the molecular formula C14H21N5O4 and a molecular weight of 323.35 g/mol. Its IUPAC name is 4-[(1,3-dimethyl-2,6-dioxopurin-7-yl)methoxy]-N,N-dimethylbutanamide.
| Compound Name | 4-[(1,3-dimethyl-2,6-dioxopurin-7-yl)methoxy]-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 23455270 |
| Molecular Formula | C14H21N5O4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 4-[(1,3-dimethyl-2,6-dioxopurin-7-yl)methoxy]-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CCCOCn1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C14H21N5O4/c1-16(2)10(20)6-5-7-23-9-19-8-15-12-11(19)13(21)18(4)14(22)17(12)3/h8H,5-7,9H2,1-4H3 |
| InChIKey | NIJGTJZPLGNEAH-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 91.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|