C12H17N5O3S — CID 23455306
S-[(1,3-dimethyl-2,6-dioxopurin-7-yl)methyl] 2-(dimethylamino)ethanethioate (PubChem CID 23455306) has the molecular formula C12H17N5O3S and a molecular weight of 311.37 g/mol. Its IUPAC name is S-[(1,3-dimethyl-2,6-dioxopurin-7-yl)methyl] 2-(dimethylamino)ethanethioate.
| Compound Name | S-[(1,3-dimethyl-2,6-dioxopurin-7-yl)methyl] 2-(dimethylamino)ethanethioate |
|---|---|
| PubChem CID | 23455306 |
| Molecular Formula | C12H17N5O3S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | S-[(1,3-dimethyl-2,6-dioxopurin-7-yl)methyl] 2-(dimethylamino)ethanethioate |
| SMILES | CN(C)CC(=O)SCn1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C12H17N5O3S/c1-14(2)5-8(18)21-7-17-6-13-10-9(17)11(19)16(4)12(20)15(10)3/h6H,5,7H2,1-4H3 |
| InChIKey | BPZIWWFBVJDGLY-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 82.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|